4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline
Modify Date: 2026-07-01 10:45:14
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline structure
|
Common Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 95752-87-7 | Molecular Weight | 233.11400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20BNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20BNO2 |
|---|---|
| Molecular Weight | 233.11400 |
| Exact Mass | 233.15900 |
| PSA | 21.70000 |
| LogP | 1.52080 |
| InChIKey | CAVDEKXYQHUYOO-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(B2OCC(C)(C)CO2)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenamine,4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: Polar surface area (PSA) of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is 21.70000. |
| Q: What is the molecular formula of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: Molecular formula of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is C13H20BNO2. |
| Q: What is the InChIKey of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: InChIKey of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is CAVDEKXYQHUYOO-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: Molecular weight of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is 233.11400. |
| Q: What is the SMILES notation of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: SMILES notation of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is CN(C)c1ccc(B2OCC(C)(C)CO2)cc1. |
| Q: What is the Chinese name of 95752-87-7? |
| A: Chinese name of 95752-87-7 is 95752-87-7. |
| Q: What is the CAS number of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: CAS number of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is 95752-87-7. |
| Q: What is the LogP of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: LogP of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is 1.52080. |
| Q: What English synonyms does 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline have? |
| A: English synonyms of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline: Benzenamine,4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethyl. |
| Q: What is the English name of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline? |
| A: The English name of 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N,N-dimethylaniline. |