2,5-Cyclohexadiene-.delta.1,.alpha.-acetonitrile, .alpha.-(p-chlorophenyl)-4-oxo-, oxime structure
|
Common Name | 2,5-Cyclohexadiene-.delta.1,.alpha.-acetonitrile, .alpha.-(p-chlorophenyl)-4-oxo-, oxime | ||
|---|---|---|---|---|
| CAS Number | 958-11-2 | Molecular Weight | 256.68700 | |
| Density | 1.22g/cm3 | Boiling Point | 440.3ºC at 760 mmHg | |
| Molecular Formula | C14H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 2-(4-chlorophenyl)-2-(4-hydroxyiminocyclohexa-2,5-dien-1-ylidene)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 440.3ºC at 760 mmHg |
| Molecular Formula | C14H9ClN2O |
| Molecular Weight | 256.68700 |
| Flash Point | 220.1ºC |
| Exact Mass | 256.04000 |
| PSA | 56.38000 |
| LogP | 3.57338 |
| Index of Refraction | 1.609 |
| InChIKey | CPQMRDWKXUVWAP-UHFFFAOYSA-N |
| SMILES | N#CC(=C1C=CC(=NO)C=C1)c1ccc(Cl)cc1 |
|
~%
2,5-Cyclohexadi... CAS#:958-11-2 |
| Literature: Dore Ch.; Viel European Journal of Medicinal Chemistry, 1975 , vol. 10, # 1 p. 47 - 54 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Chlorphenylcyanomethylen-p-benzochinon-oxim |
| p-Chlorphenylcyanomethylenchinon-oxim |