RMGPa-IN-1
Modify Date: 2026-04-12 20:55:51
RMGPa-IN-1 structure
|
Common Name | RMGPa-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 958237-73-5 | Molecular Weight | 514.799 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H54O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | RMGPa-IN-1 |
|---|
| Molecular Formula | C33H54O4 |
|---|---|
| Molecular Weight | 514.799 |
| InChIKey | PKWCYQYJRALNAD-IHYXPCQHSA-N |
| SMILES | CCCOC(=O)[C@]12CC[C@H]([C@@H]([C@H]1C3=CC[C@H]4[C@]([C@@]3(CC2)C)(CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5(C)C)O)O)C)C)C)C |
|
Name: Inhibition of rabbit muscle glycogen phosphorylase A assessed as release of phosphate...
Source: ChEMBL
Target: Glycogen phosphorylase, muscle form
External Id: CHEMBL1799389
|
|
Name: Inhibition of rabbit muscle glycogen phosphorylase a
Source: ChEMBL
Target: N/A
External Id: CHEMBL898956
|
Total 2, Current Page 1 of 1
1