4-methoxynaphthalene-1-sulfonamide structure
|
Common Name | 4-methoxynaphthalene-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 95834-50-7 | Molecular Weight | 237.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methoxynaphthalene-1-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO3S |
|---|---|
| Molecular Weight | 237.27500 |
| Exact Mass | 237.04600 |
| PSA | 77.77000 |
| LogP | 3.27690 |
| InChIKey | ZQHDRZCQJLIEIP-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(N)(=O)=O)c2ccccc12 |
|
~%
4-methoxynaphth... CAS#:95834-50-7 |
| Literature: Huntress; Carten Journal of the American Chemical Society, 1940 , vol. 62, p. 603 |
| 1-Naphthalenesulfonamide,4-methoxy |
| 4-methoxy-naphthalene-1-sulfonic acid amide |
| 4-Methoxy-naphthalin-1-sulfonsaeure-amid |
| 4-methoxynaphthalenesulfonamide |