3-Pyridinemethanol, 4-phenyl-, 3-acetate
Modify Date: 2025-11-08 15:33:00
3-Pyridinemethanol, 4-phenyl-, 3-acetate structure
|
Common Name | 3-Pyridinemethanol, 4-phenyl-, 3-acetate | ||
|---|---|---|---|---|
| CAS Number | 95835-91-9 | Molecular Weight | 227.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Pyridinemethanol, 4-phenyl-, 3-acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13NO2 |
|---|---|
| Molecular Weight | 227.26 |
| InChIKey | IWVVVAQJDDEHBD-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cnccc1-c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-Pyridinemethanol, 4-phenyl-, 3-acetate? |
| A: The English name of 3-Pyridinemethanol, 4-phenyl-, 3-acetate is 3-Pyridinemethanol, 4-phenyl-, 3-acetate. |
| Q: What is the SMILES notation of 3-Pyridinemethanol, 4-phenyl-, 3-acetate? |
| A: SMILES notation of 3-Pyridinemethanol, 4-phenyl-, 3-acetate is CC(=O)OCc1cnccc1-c1ccccc1. |
| Q: What is the molecular formula of 3-Pyridinemethanol, 4-phenyl-, 3-acetate? |
| A: Molecular formula of 3-Pyridinemethanol, 4-phenyl-, 3-acetate is C14H13NO2. |
| Q: What is the CAS number of 3-Pyridinemethanol, 4-phenyl-, 3-acetate? |
| A: CAS number of 3-Pyridinemethanol, 4-phenyl-, 3-acetate is 95835-91-9. |
| Q: What is the Chinese name of 95835-91-9? |
| A: Chinese name of 95835-91-9 is 95835-91-9. |
| Q: What is the molecular weight of 3-Pyridinemethanol, 4-phenyl-, 3-acetate? |
| A: Molecular weight of 3-Pyridinemethanol, 4-phenyl-, 3-acetate is 227.26. |
| Q: What is the InChIKey of 3-Pyridinemethanol, 4-phenyl-, 3-acetate? |
| A: InChIKey of 3-Pyridinemethanol, 4-phenyl-, 3-acetate is IWVVVAQJDDEHBD-UHFFFAOYSA-N. |