(2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal
Modify Date: 2025-09-10 00:10:52
![(2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal Structure](https://www.chemsrc.com/extcaspic/029/958447-29-5.png)
(2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal structure
|
Common Name | (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal | ||
|---|---|---|---|---|
| CAS Number | 958447-29-5 | Molecular Weight | 238.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22O3 |
|---|---|
| Molecular Weight | 238.32 |
| InChIKey | RTBJZMMNKXQFDB-AAXDQBDMSA-N |
| SMILES | CC(=O)CCC1C(=O)C(C(C)C=O)CCC1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal? |
| A: Molecular formula of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal is C14H22O3. |
| Q: What is the CAS number of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal? |
| A: CAS number of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal is 958447-29-5. |
| Q: What is the InChIKey of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal? |
| A: InChIKey of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal is RTBJZMMNKXQFDB-AAXDQBDMSA-N. |
| Q: What is the molecular weight of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal? |
| A: Molecular weight of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal is 238.32. |
| Q: What is the SMILES notation of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal? |
| A: SMILES notation of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal is CC(=O)CCC1C(=O)C(C(C)C=O)CCC1C. |
| Q: What is the English name of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal? |
| A: The English name of (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal is (2S)-2-[(1S,3S,4R)-4-methyl-2-oxo-3-(3-oxobutyl)cyclohexyl]propanal. |
| Q: What is the Chinese name of 958447-29-5? |
| A: Chinese name of 958447-29-5 is 958447-29-5. |