2-pyridin-3-yl-1h-indole-3-carbaldehyde structure
|
Common Name | 2-pyridin-3-yl-1h-indole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 95854-06-1 | Molecular Weight | 222.24200 | |
| Density | 1.291g/cm3 | Boiling Point | 492ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.2ºC | |
| Name | 2-pyridin-3-yl-1h-indole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 492ºC at 760 mmHg |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.24200 |
| Flash Point | 248.2ºC |
| Exact Mass | 222.07900 |
| PSA | 45.75000 |
| LogP | 3.04240 |
| Index of Refraction | 1.72 |
| InChIKey | SQVYVEPAYPBNHI-UHFFFAOYSA-N |
| SMILES | O=Cc1c(-c2cccnc2)[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
2-pyridin-3-yl-... CAS#:95854-06-1 |
| Literature: Ciba-Geigy Corporation Patent: US4511573 A1, 1985 ; |
|
~38%
Detail
|
| Literature: Somei, Masanori; Sayama, Shinsuke; Naka, Katsumi; Shinmoto, Kotaro; Yamada, Fumio Heterocycles, 2007 , vol. 73, # C p. 537 - 554 |
|
~39%
2-pyridin-3-yl-... CAS#:95854-06-1 |
| Literature: Somei, Masanori; Sayama, Shinsuke; Naka, Katsumi; Yamada, Fumio Heterocycles, 1988 , vol. 27, # 7 p. 1585 - 1588 |
|
~%
2-pyridin-3-yl-... CAS#:95854-06-1 |
| Literature: Nikken Chemicals Co., Ltd. Patent: US6184238 B2, 2001 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-pyridyl)indole-3-carbaldehyde |
| 2-(3pyridyl)-indole-3-carboxaldehyde |
| 3-[2-(3-pyridyl)indole]aldehyde |
| 2-(pyridin-3-yl)-1H-indole-3-carbaldehyde |