(1,1,2,4,6-pentamethylheptyl)benzenesulphonic acid, compound with N-methylcyclohexylamine (1:1) structure
|
Common Name | (1,1,2,4,6-pentamethylheptyl)benzenesulphonic acid, compound with N-methylcyclohexylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 95892-15-2 | Molecular Weight | 439.69500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H45NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methylcyclohexanamine,2-(2,3,5,7-tetramethyloctan-2-yl)benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H45NO3S |
|---|---|
| Molecular Weight | 439.69500 |
| Exact Mass | 439.31200 |
| PSA | 74.78000 |
| LogP | 7.92950 |
| InChIKey | OHBHSUZBANOLGI-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)CC(C)C(C)(C)c1ccccc1S(=O)(=O)O.CNC1CCCCC1 |
| (1,1,2,4,6-Pentamethylheptyl)benzenesulphonic acid,compound with N-methylcyclohexylamine (1:1) |
| EINECS 306-074-3 |