Benzenamine,4-[[(4-chlorophenyl)thio]methyl]-N,N-dimethyl
Modify Date: 2025-09-22 10:05:30
![Benzenamine,4-[[(4-chlorophenyl)thio]methyl]-N,N-dimethyl Structure](https://image.chemsrc.com/caspic/465/959-82-0.png)
Benzenamine,4-[[(4-chlorophenyl)thio]methyl]-N,N-dimethyl structure
|
Common Name | Benzenamine,4-[[(4-chlorophenyl)thio]methyl]-N,N-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 959-82-0 | Molecular Weight | 277.81200 | |
| Density | 1.2g/cm3 | Boiling Point | 406.7ºC at 760mmHg | |
| Molecular Formula | C15H16ClNS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.7ºC | |
| Name | 4-(((4-chlorophenyl)thio)methyl)-N,N-dimethylaniline |
|---|
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 406.7ºC at 760mmHg |
| Molecular Formula | C15H16ClNS |
| Molecular Weight | 277.81200 |
| Flash Point | 199.7ºC |
| Exact Mass | 277.06900 |
| PSA | 28.54000 |
| LogP | 4.69830 |
| Index of Refraction | 1.629 |
| InChIKey | VSUBVIKLKNWUKN-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(CSc2ccc(Cl)cc2)cc1 |
|
~%
Benzenamine,4-[... CAS#:959-82-0 |
| Literature: Grillot,G.F.; Lau,P.T.S. Journal of Organic Chemistry, 1965 , vol. 30, p. 28 - 33 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1