4-(3-Fluorophenyl)piperidine-2,6-dione structure
|
Common Name | 4-(3-Fluorophenyl)piperidine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 959246-81-2 | Molecular Weight | 207.20100 | |
| Density | 1.264g/cm3 | Boiling Point | 384.7ºC at 760 mmHg | |
| Molecular Formula | C11H10FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.5ºC | |
| Name | 4-(3-Fluorophenyl)piperidine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 384.7ºC at 760 mmHg |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20100 |
| Flash Point | 186.5ºC |
| Exact Mass | 207.07000 |
| PSA | 46.17000 |
| LogP | 1.67470 |
| Index of Refraction | 1.536 |
| InChIKey | HHCHNRJQUCGHTO-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2cccc(F)c2)CC(=O)N1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(3-fluorophenyl)piperidine-2,6-dione |