3-(1,3-benzodioxol-5-yl)-N-(2-phenylethyl)prop-2-enamide structure
|
Common Name | 3-(1,3-benzodioxol-5-yl)-N-(2-phenylethyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 95925-01-2 | Molecular Weight | 295.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(1,3-benzodioxol-5-yl)-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H17NO3 |
|---|---|
| Molecular Weight | 295.33200 |
| Exact Mass | 295.12100 |
| PSA | 51.05000 |
| LogP | 3.62770 |
| InChIKey | VZRQWUCOQKDDBC-VQHVLOKHSA-N |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NCCc1ccccc1 |
|
~45%
3-(1,3-benzodio... CAS#:95925-01-2 |
| Literature: Schobert; Siegfried; Gordon Journal of the Chemical Society. Perkin Transactions 1, 2001 , # 19 p. 2393 - 2397 |
| 2-Propenamide,3-(1,3-benzodioxol-5-yl)-N-(2-phenylethyl)-,(E) |
| (E)-N-phenethyl-3',4'-(methylenedioxy)cinnamamide |
| 3-(1,3-benzodioxol-5-yl)-N-phenethylprop-2-enamide |