4-Hydroxyalternariol 9-methyl ether structure
|
Common Name | 4-Hydroxyalternariol 9-methyl ether | ||
|---|---|---|---|---|
| CAS Number | 959417-17-5 | Molecular Weight | 288.25 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 584.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.0±23.6 °C | |
Use of 4-Hydroxyalternariol 9-methyl ether4-Hydroxyalternariol-9-methyl ether can be isolated from an endolichenic fungal strain Nigrospora sphaerica (No.83-1-1-2), endolichenic fungal strains Alternaria alternata (No.58-8-4-1) and Phialophora sp. (No.96-1-8-1)[1]. |
| Name | 3,4,7-Trihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Hydroxyalternariol-9-methyl ether can be isolated from an endolichenic fungal strain Nigrospora sphaerica (No.83-1-1-2), endolichenic fungal strains Alternaria alternata (No.58-8-4-1) and Phialophora sp. (No.96-1-8-1)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 584.7±50.0 °C at 760 mmHg |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 |
| Flash Point | 226.0±23.6 °C |
| Exact Mass | 288.063385 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | BVYAURIYXKOUPX-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)oc3c(O)c(O)cc(C)c3c2c1 |
| 6H-Dibenzo[b,d]pyran-6-one, 3,4,7-trihydroxy-9-methoxy-1-methyl- |
| 3,4,7-Trihydroxy-9-methoxy-1-methyl-6H-benzo[c]chromen-6-one |