[5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester
Modify Date: 2026-07-14 14:27:57
![[5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester Structure](https://www.chemsrc.com/extcaspic/441/959682-16-7.png)
[5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester structure
|
Common Name | [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 959682-16-7 | Molecular Weight | 368.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20N2O6S |
|---|---|
| Molecular Weight | 368.4 |
| InChIKey | NPMZEPKANAWKJH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1OC)n1cncc1CCOS(C)(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester? |
| A: InChIKey of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester is NPMZEPKANAWKJH-UHFFFAOYSA-N. |
| Q: What is the English name of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester? |
| A: The English name of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester is [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester. |
| Q: What is the CAS number of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester? |
| A: CAS number of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester is 959682-16-7. |
| Q: What is the molecular formula of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester? |
| A: Molecular formula of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester is C16H20N2O6S. |
| Q: What is the SMILES notation of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester? |
| A: SMILES notation of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester is COC(=O)C(c1ccccc1OC)n1cncc1CCOS(C)(=O)=O. |
| Q: What is the Chinese name of 959682-16-7? |
| A: Chinese name of 959682-16-7 is 959682-16-7. |
| Q: What is the molecular weight of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester? |
| A: Molecular weight of [5-(2-Methanesulfonyloxy-ethyl)-imidazol-1-yl]-(2-methoxyphenyl)acetic acid methyl ester is 368.4. |