(4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester
Modify Date: 2026-06-30 00:27:08
![(4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester Structure](https://www.chemsrc.com/extcaspic/433/959866-14-9.png)
(4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester structure
|
Common Name | (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 959866-14-9 | Molecular Weight | 274.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H22N2O2 |
|---|---|
| Molecular Weight | 274.36 |
| InChIKey | IGUAZWDLXURGFT-UHFFFAOYSA-N |
| SMILES | NC12CCC(NC(=O)OCc3ccccc3)(CC1)CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester? |
| A: Molecular formula of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester is C16H22N2O2. |
| Q: What is the InChIKey of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester? |
| A: InChIKey of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester is IGUAZWDLXURGFT-UHFFFAOYSA-N. |
| Q: What is the English name of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester? |
| A: The English name of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester is (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester. |
| Q: What is the molecular weight of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester? |
| A: Molecular weight of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester is 274.36. |
| Q: What is the SMILES notation of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester? |
| A: SMILES notation of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester is NC12CCC(NC(=O)OCc3ccccc3)(CC1)CC2. |
| Q: What is the Chinese name of 959866-14-9? |
| A: Chinese name of 959866-14-9 is 959866-14-9. |
| Q: What is the CAS number of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester? |
| A: CAS number of (4-Amino-bicyclo[2.2.2]oct-1-yl)-carbamic acid benzyl ester is 959866-14-9. |