ethyl 4-(pyrimidin-2-ylamino)benzoate structure
|
Common Name | ethyl 4-(pyrimidin-2-ylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 959928-89-3 | Molecular Weight | 243.26100 | |
| Density | 1.239g/cm3 | Boiling Point | 415.565ºC at 760 mmHg | |
| Molecular Formula | C13H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.126ºC | |
| Name | ethyl 4-(pyrimidin-2-ylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 415.565ºC at 760 mmHg |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.26100 |
| Flash Point | 205.126ºC |
| Exact Mass | 243.10100 |
| PSA | 64.11000 |
| LogP | 2.46990 |
| Index of Refraction | 1.612 |
| InChIKey | QZNMTAJPWIVICE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(Nc2ncccn2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(pyrimidin-2-ylamino)benzoic acid ethyl ester |