Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl)
Modify Date: 2025-11-25 21:43:28
Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl) structure
|
Common Name | Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl) | ||
|---|---|---|---|---|
| CAS Number | 96-68-4 | Molecular Weight | 230.28100 | |
| Density | 1.301g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-2-methyl-5-propan-2-ylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.301g/cm3 |
|---|---|
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28100 |
| Exact Mass | 230.06100 |
| PSA | 82.98000 |
| LogP | 3.15150 |
| Index of Refraction | 1.558 |
| InChIKey | LYWNNXMNOSKLHY-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(C(C)C)cc1S(=O)(=O)O |
| HS Code | 2908999090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:490-91-5
CAS#:303-21-9| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| Thymol-6-sulfonic acid |
| 6-Thymolsulfonic acid |
| Benzenesulfonic acid,4-hydroxy-2-methyl-5-(1-methylethyl) |
| Thymolsulfonic acid |
| p-Cymene-2-sulfonic acid,5-hydroxy |