2-methyl-5-propan-2-ylbenzenesulfonic acid
Modify Date: 2025-08-27 10:11:53
2-methyl-5-propan-2-ylbenzenesulfonic acid structure
|
Common Name | 2-methyl-5-propan-2-ylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 96-71-9 | Molecular Weight | 214.28100 | |
| Density | 1.2 | Boiling Point | N/A | |
| Molecular Formula | C10H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-5-propan-2-ylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2 |
|---|---|
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.28100 |
| Exact Mass | 214.06600 |
| PSA | 62.75000 |
| LogP | 3.44590 |
| Index of Refraction | 1.534 |
| InChIKey | OORBHYFTTSLSRU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)cc1S(=O)(=O)O |
| HS Code | 2904100000 |
|---|
|
~92%
2-methyl-5-prop... CAS#:96-71-9 |
| Literature: Clark, James H.; Fitzpatrick, Emma M.; MacQuarrie, Duncan J.; Pfaltzgraff, Lucie A.; Sherwood, James Catalysis Today, 2012 , vol. 190, # 1 p. 144 - 149 |
|
~90%
2-methyl-5-prop... CAS#:96-71-9 |
| Literature: Krylov, E. N.; Korobtsova, I. V. J. Gen. Chem. USSR (Engl. Transl.), 1984 , vol. 54, # 5 p. 1169 - 1173,1046 - 1049 |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-methyl-5-(1-methylethyl)-benzenesulfonic acid |
| p-cyneme-2-sulphonic acid |
| 2-Methyl-5-isopropylbenzolsulfosaeure |
| 5-Isopropyl-2-methyl-benzolsulfonsaeure |
| 2-METHYL-5-ISOPROPYLBENZENESULFONIC ACID |
| 5-isopropyl-2-methyl-benzenesulfonic acid |
| p-cumene-2-sulphonic acid |