2-(Methylsulfonyl)-4-nitroaniline structure
|
Common Name | 2-(Methylsulfonyl)-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 96-74-2 | Molecular Weight | 216.214 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 500.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.6±30.1 °C | |
| Name | 2-methylsulfonyl-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 500.6±50.0 °C at 760 mmHg |
| Molecular Formula | C7H8N2O4S |
| Molecular Weight | 216.214 |
| Flash Point | 256.6±30.1 °C |
| Exact Mass | 216.020477 |
| PSA | 114.36000 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | KIMXIMWZIRTKCQ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])ccc1N |
| HS Code | 2921420090 |
|---|
|
~%
2-(Methylsulfon... CAS#:96-74-2 |
| Literature: Industrial and Engineering Chemistry, , vol. 45, p. 1730,1732 Industrial and Engineering Chemistry, , vol. 46, p. 2213,2218, 2219 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-Amino-2-methylsulphonyl-4-nitrobenzene |
| 2-methanesulfonyl-4-nitroaniline |
| MFCD00044068 |
| 2-Methansulfonyl-4-nitro-anilin |
| 2-Mesyl-4-nitroaniline |
| EINECS 202-529-4 |
| Benzenamine, 2-(methylsulfonyl)-4-nitro- |
| 2-(Methylsulfonyl)-4-nitroaniline |