Carbubarb structure
|
Common Name | Carbubarb | ||
|---|---|---|---|---|
| CAS Number | 960-05-4 | Molecular Weight | 271.27000 | |
| Density | 1.242g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-butyl-2,4,6-trioxo-1,3-diazinan-5-yl)ethyl carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27000 |
| Exact Mass | 271.11700 |
| PSA | 135.56000 |
| LogP | 1.08000 |
| Index of Refraction | 1.491 |
| InChIKey | ZWGPHQZXAPWKOV-UHFFFAOYSA-N |
| SMILES | CCCCC1(CCOC(N)=O)C(=O)NC(=O)NC1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Tylemalum |
| Carbubarbe [INN-French] |
| 5-butyl-5-(2-carbamoyloxy-ethyl)-pyrimidine-2,4,6-trione |
| Carbubarbo [INN-Spanish] |
| Carbubarb |
| Carbubarbum [INN-Latin] |
| Carbubarbital |
| 5-Butyl-5-(2-carbamoyloxyethyl)barbitursaeure |
| 5-Butyl-5-carbamoyloxyethylbarbituric acid |
| 5-n-Butyl-5-<2-carbamoyloxy-ethyl>-barbitursaeure |
| Nogexan |