2-Sulfanilamido-5-nitrothiazole
2-Sulfanilamido-5-nitrothiazole structure
|
Common Name | 2-Sulfanilamido-5-nitrothiazole | ||
|---|---|---|---|---|
| CAS Number | 960-34-9 | Molecular Weight | 300.31400 | |
| Density | 1.712 | Boiling Point | N/A | |
| Molecular Formula | C9H8N4O4S2 | Melting Point | 216-218ºC | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.712 |
|---|---|
| Melting Point | 216-218ºC |
| Molecular Formula | C9H8N4O4S2 |
| Molecular Weight | 300.31400 |
| Exact Mass | 299.99900 |
| PSA | 167.52000 |
| LogP | 3.69250 |
| InChIKey | AFFXCPACBHRYJM-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ncc([N+](=O)[O-])s2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-Sulfanilamido... CAS#:960-34-9 |
| Literature: Ganapathi; Venkataraman Proceedings - Indian Academy of Sciences, Section A, 1948 , # 28 p. 556,559 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Sulfanilamido-5-nitrothiazol |
| Sulfanilsaeure-(5-nitro-thiazol-2-ylamid) |
| sulfanilic acid-(5-nitro-thiazol-2-ylamide) |
| 4-AMINO-N-(5-NITRO-2-THIAZOLYL)BENZENESULFONAMIDE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: The English name of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide. |
| Q: What is the SMILES notation of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: SMILES notation of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is Nc1ccc(S(=O)(=O)Nc2ncc([N+](=O)[O-])s2)cc1. |
| Q: What is the melting point of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: Melting point of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is 216-218ºC. |
| Q: What is the molecular formula of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: Molecular formula of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is C9H8N4O4S2. |
| Q: What is the InChIKey of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: InChIKey of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is AFFXCPACBHRYJM-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: LogP of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is 3.69250. |
| Q: What is the molecular weight of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: Molecular weight of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is 300.31400. |
| Q: What is the CAS number of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: CAS number of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is 960-34-9. |
| Q: What are the upstream materials of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: Related upstream materials(CAS) of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide: 3034-48-8. |
| Q: What is the polar surface area (PSA) of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide? |
| A: Polar surface area (PSA) of 4-Amino-N-(5-nitro-1,3-thiazol-2-yl)benzenesulfonamide is 167.52000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |