[(3aS,5aR,8aR)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydrodi[1,3]dioxolo[4,5-a:5',3'-d]pyran-3a-yl]methyl sulfamate,2-methyl-1-phenylpropan-2-amine structure
|
Common Name | [(3aS,5aR,8aR)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydrodi[1,3]dioxolo[4,5-a:5',3'-d]pyran-3a-yl]methyl sulfamate,2-methyl-1-phenylpropan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 960078-81-3 | Molecular Weight | 488.59500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H36N2O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(3aS,5aR,8aR)-2,2,7,7-tetramethyl-5,5a,8a,8b-tetrahydrodi[1,3]dioxolo[4,5-a:5',3'-d]pyran-3a-yl]methyl sulfamate,2-methyl-1-phenylpropan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H36N2O8S |
|---|---|
| Molecular Weight | 488.59500 |
| Exact Mass | 488.21900 |
| PSA | 149.94000 |
| LogP | 4.05240 |
| InChIKey | PWDLDBWXTVILPC-WGAVTJJLSA-N |
| SMILES | CC(C)(N)Cc1ccccc1.CC1(C)OC2COC3(COS(N)(=O)=O)OC(C)(C)OC3C2O1 |
| Topiramate / Phentermine |
| Qsymia |
| Phentermine mixture with topiramate |
| Phentermine / topiramate |
| Qnexa |
| Phentermine and topiramate |
| VI-0521 |
| Qsiva |