Boivinide E
Modify Date: 2026-06-25 18:09:03
Boivinide E structure
|
Common Name | Boivinide E | ||
|---|---|---|---|---|
| CAS Number | 960233-32-3 | Molecular Weight | 710.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H54O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Boivinide E |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H54O14 |
|---|---|
| Molecular Weight | 710.8 |
| InChIKey | YRNGTFHYGBEEKX-RDLUFXFASA-N |
| SMILES | C[C@@H]1[C@@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@]3([C@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(CC[C@@H]5C6=CC(=O)OC6)O)C)C(=O)O)OC)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiproliferative activity against human A2780 cells
Source: ChEMBL
Target: A2780
External Id: CHEMBL942994
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Boivinide E? |
| A: Molecular weight of Boivinide E is 710.8. |
| Q: What is the English name of Boivinide E? |
| A: The English name of Boivinide E is Boivinide E. |
| Q: What is the Chinese name of 960233-32-3? |
| A: Chinese name of 960233-32-3 is 960233-32-3. |
| Q: What is the InChIKey of Boivinide E? |
| A: InChIKey of Boivinide E is YRNGTFHYGBEEKX-RDLUFXFASA-N. |
| Q: What is the SMILES notation of Boivinide E? |
| A: SMILES notation of Boivinide E is C[C@@H]1[C@@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@]3([C@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(CC[C@@H]5C6=CC(=O)OC6)O)C)C(=O)O)OC)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O. |
| Q: What is the CAS number of Boivinide E? |
| A: CAS number of Boivinide E is 960233-32-3. |
| Q: What is the molecular formula of Boivinide E? |
| A: Molecular formula of Boivinide E is C36H54O14. |