1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl
Modify Date: 2026-09-25 19:27:18
1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl structure
|
Common Name | 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl | ||
|---|---|---|---|---|
| CAS Number | 960235-12-5 | Molecular Weight | 251.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H9N3O2 |
|---|---|
| Molecular Weight | 251.24 |
| InChIKey | PTGNFSNWFYPRHS-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(C#N)c(C(=O)O)c1-c1ccc(C#N)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl? |
| A: SMILES notation of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl is Cc1[nH]c(C#N)c(C(=O)O)c1-c1ccc(C#N)cc1. |
| Q: What is the CAS number of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl? |
| A: CAS number of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl is 960235-12-5. |
| Q: What is the molecular formula of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl? |
| A: Molecular formula of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl is C14H9N3O2. |
| Q: What is the InChIKey of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl? |
| A: InChIKey of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl is PTGNFSNWFYPRHS-UHFFFAOYSA-N. |
| Q: What is the English name of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl? |
| A: The English name of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl is 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl. |
| Q: What is the Chinese name of 960235-12-5? |
| A: Chinese name of 960235-12-5 is 960235-12-5. |
| Q: What is the molecular weight of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl? |
| A: Molecular weight of 1H-Pyrrole-3-carboxylic acid, 2-cyano-4-(4-cyanophenyl)-5-methyl is 251.24. |