2-Bromo-1-[(2-methyl-2-propanyl)oxy]-4-nitrobenzene structure
|
Common Name | 2-Bromo-1-[(2-methyl-2-propanyl)oxy]-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 960309-85-7 | Molecular Weight | 274.11100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Bromo-1-[(2-methyl-2-propanyl)oxy]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12BrNO3 |
|---|---|
| Molecular Weight | 274.11100 |
| Exact Mass | 273.00000 |
| PSA | 55.05000 |
| LogP | 4.05780 |
| InChIKey | KMOHHDFKKROOFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Oc1ccc([N+](=O)[O-])cc1Br |
|
~58%
2-Bromo-1-[(2-m... CAS#:960309-85-7 |
| Literature: Rousseaux, Sophie; Gorelsky, Serge I.; Chung, Benjamin K. W.; Fagnou, Keith Journal of the American Chemical Society, 2010 , vol. 132, # 31 p. 10692 - 10705 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-tert-butoxy-2-bromo-4-nitrobenzene |
| 3-Pentanone,1-(1,1-dimethylethoxy)-2,2,4-trimethyl |
| 1-tert-butoxy-2,2,4-trimethyl-pentan-3-one |