(4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester
Modify Date: 2025-11-06 10:58:56
![(4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester Structure](https://www.chemsrc.com/extcaspic/055/960398-39-4.png)
(4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester structure
|
Common Name | (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 960398-39-4 | Molecular Weight | 484.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H32N2O4 |
|---|---|
| Molecular Weight | 484.6 |
| InChIKey | SXURJCLTBDFNJQ-UHFFFAOYSA-N |
| SMILES | O=C(NCCCCc1ccc(CCCCN2C(=O)c3ccccc3C2=O)cc1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester? |
| A: SMILES notation of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester is O=C(NCCCCc1ccc(CCCCN2C(=O)c3ccccc3C2=O)cc1)OCc1ccccc1. |
| Q: What is the Chinese name of 960398-39-4? |
| A: Chinese name of 960398-39-4 is 960398-39-4. |
| Q: What is the molecular formula of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester? |
| A: Molecular formula of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester is C30H32N2O4. |
| Q: What is the CAS number of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester? |
| A: CAS number of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester is 960398-39-4. |
| Q: What is the InChIKey of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester? |
| A: InChIKey of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester is SXURJCLTBDFNJQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester? |
| A: Molecular weight of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester is 484.6. |
| Q: What is the English name of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester? |
| A: The English name of (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester is (4-{4-[4-(1,3-Dioxo-1,3-dihydroisoindol-2-yl)butyl]phenyl}butyl)carbamic acid benzyl ester. |