2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate
Modify Date: 2026-07-09 11:45:10
2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate structure
|
Common Name | 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 960403-11-6 | Molecular Weight | 414.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H22N2O5S |
|---|---|
| Molecular Weight | 414.5 |
| InChIKey | KSOMVYFOMXATKR-QGZVFWFLSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC(=O)c2cncn2C(C)c2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate? |
| A: InChIKey of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate is KSOMVYFOMXATKR-QGZVFWFLSA-N. |
| Q: What is the CAS number of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate? |
| A: CAS number of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate is 960403-11-6. |
| Q: What is the SMILES notation of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate? |
| A: SMILES notation of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate is Cc1ccc(S(=O)(=O)OCCOC(=O)c2cncn2C(C)c2ccccc2)cc1. |
| Q: What is the molecular formula of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate? |
| A: Molecular formula of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate is C21H22N2O5S. |
| Q: What is the English name of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate? |
| A: The English name of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate is 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate. |
| Q: What is the Chinese name of 960403-11-6? |
| A: Chinese name of 960403-11-6 is 960403-11-6. |
| Q: What is the molecular weight of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate? |
| A: Molecular weight of 2-(Tosyloxy)ethyl (R)-1-(1-phenylethyl)-1H-imidazole-5-carboxylate is 414.5. |