N-(tert-Butoxycarbonyl)-D-threonine Methyl Ester structure
|
Common Name | N-(tert-Butoxycarbonyl)-D-threonine Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 96099-84-2 | Molecular Weight | 233.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172 °C | |
Use of N-(tert-Butoxycarbonyl)-D-threonine Methyl EsterN-(tert-Butoxycarbonyl)-D-threonine Methyl Ester is a threonine derivative[1]. |
| Name | Boc-L-Thr-OMe |
|---|---|
| Synonym | More Synonyms |
| Description | N-(tert-Butoxycarbonyl)-D-threonine Methyl Ester is a threonine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C10H19NO5 |
|---|---|
| Molecular Weight | 233.26200 |
| Flash Point | 172 °C |
| Exact Mass | 233.12600 |
| PSA | 84.86000 |
| LogP | 0.82440 |
| Index of Refraction | 1.45 |
| InChIKey | MZMWAPNVRMDIPS-NKWVEPMBSA-N |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(C)O |
| Boc-D-Thr-OMe |
| N-(tertbutoxycarbonyl)-D-threonine methyl ester |
| N-(tert-butoxycarbonyl)-D-theronine methyl ester |
| (2R,3S)-methyl 2-[(tert-butoxycarbonyl)amino]-3-hydroxybutanoate |
| (2R,3S)-2-tert-Butoxycarbonylamino-3-hydroxy-butyric acid methyl ester |
| (2R,3S)-methyl 2-<(tert-butoxycarbonyl)amino>-3-hydroxybutanoate |
| 2-tert-butoxycarbonylamino-3-hydroxybutyric acid methyl ester |