Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate structure
|
Common Name | Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 961-69-3 | Molecular Weight | 301.379 | |
| Density | N/A | Boiling Point | 429.4ºC at 760mmHg | |
| Molecular Formula | C14H16KNO4 | Melting Point | 230-234 °C(lit.) | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | Potassium (R,E)-2-((4-ethoxy-4-oxobut-2-en-2-yl)amino)-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 429.4ºC at 760mmHg |
|---|---|
| Melting Point | 230-234 °C(lit.) |
| Molecular Formula | C14H16KNO4 |
| Molecular Weight | 301.379 |
| Flash Point | 213.5ºC |
| Exact Mass | 301.071625 |
| PSA | 78.46000 |
| LogP | 0.92500 |
| InChIKey | QMWWAEFYIXXXQW-VMEHJNRZSA-M |
| SMILES | CCOC(=O)C=C(C)NC(C(=O)[O-])c1ccccc1.[K+] |
| Storage condition | -20°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Potassium (2R)-{[(2E)-4-ethoxy-4-oxo-2-buten-2-yl]amino}(phenyl)acetate |
| EINECS 213-510-5 |
| Potassium (R)-[(3-ethoxy-1-methyl-3-oxoprop-1-enyl)amino]phenylacetate |
| MFCD00137489 |
| Benzeneacetic acid, α-[[(1E)-3-ethoxy-1-methyl-3-oxo-1-propen-1-yl]amino]-, potassium salt, (αR)- (1:1) |