3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione
Modify Date: 2026-03-27 21:22:48
![3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione Structure](https://www.chemsrc.com/extcaspic/499/96159-01-2.png)
3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione structure
|
Common Name | 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 96159-01-2 | Molecular Weight | 400.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H28N2O2 |
|---|---|
| Molecular Weight | 400.5 |
| InChIKey | AVOIPCMJSAQBDN-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C(c3ccccc3)N(CCCC)C(=O)C2=C1c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione? |
| A: The English name of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione is 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione. |
| Q: What is the molecular formula of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione? |
| A: Molecular formula of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione is C26H28N2O2. |
| Q: What is the SMILES notation of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione? |
| A: SMILES notation of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione is CCCCN1C(=O)C2=C(c3ccccc3)N(CCCC)C(=O)C2=C1c1ccccc1. |
| Q: What is the Chinese name of 96159-01-2? |
| A: Chinese name of 96159-01-2 is 96159-01-2. |
| Q: What is the molecular weight of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione? |
| A: Molecular weight of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione is 400.5. |
| Q: What is the InChIKey of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione? |
| A: InChIKey of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione is AVOIPCMJSAQBDN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione? |
| A: CAS number of 3,6-diphenyl-N,N'-dibutylpyrrolo[3,4-c]pyrrole-1,4-dione is 96159-01-2. |