1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole
Modify Date: 2025-09-14 18:41:34
![1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole Structure](https://www.chemsrc.com/extcaspic/233/96159-08-9.png)
1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole structure
|
Common Name | 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole | ||
|---|---|---|---|---|
| CAS Number | 96159-08-9 | Molecular Weight | 460.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H24N2O6 |
|---|---|
| Molecular Weight | 460.5 |
| InChIKey | HQUHYXRYEJLEGG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C2=C(c3ccccc3)N(CC(=O)OCC)C(=O)C2=C1c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole? |
| A: CAS number of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole is 96159-08-9. |
| Q: What is the molecular formula of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole? |
| A: Molecular formula of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole is C26H24N2O6. |
| Q: What is the SMILES notation of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole? |
| A: SMILES notation of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole is CCOC(=O)CN1C(=O)C2=C(c3ccccc3)N(CC(=O)OCC)C(=O)C2=C1c1ccccc1. |
| Q: What is the English name of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole? |
| A: The English name of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole is 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole. |
| Q: What is the molecular weight of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole? |
| A: Molecular weight of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole is 460.5. |
| Q: What is the InChIKey of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole? |
| A: InChIKey of 1,4-Diketo-2,5-di-(carboethoxymethyl)-3,6-diphenylpyrrolo-[3,4-c]-pyrrole is HQUHYXRYEJLEGG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 96159-08-9? |
| A: Chinese name of 96159-08-9 is 96159-08-9. |