trans-4-[4-[1-(E)-propenyl]cyclohexyl]benzonitrile structure
|
Common Name | trans-4-[4-[1-(E)-propenyl]cyclohexyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 96184-40-6 | Molecular Weight | 225.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19N | Melting Point | 66 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-{trans-4-[(1E)-1-Propen-1-yl]cyclohexyl}benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 66 °C |
|---|---|
| Molecular Formula | C16H19N |
| Molecular Weight | 225.32900 |
| Exact Mass | 225.15200 |
| PSA | 23.79000 |
| LogP | 4.40818 |
| InChIKey | WFVBLRKVRNUULX-NSCUHMNNSA-N |
| SMILES | CC=CC1CCC(c2ccc(C#N)cc2)CC1 |
| HS Code | 2926909090 |
|---|
|
~%
trans-4-[4-[1-(... CAS#:96184-40-6 |
| Literature: Petrzilka, Martin Molecular Crystals and Liquid Crystals (1969-1991), 1985 , vol. 131, p. 109 - 124 |
|
~%
trans-4-[4-[1-(... CAS#:96184-40-6 |
| Literature: Petrzilka, Martin Molecular Crystals and Liquid Crystals (1969-1991), 1985 , vol. 131, p. 109 - 124 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Merphalan |
| D-Sarcolysin |
| Sarcoclorin |
| 4-(bis(2-chloroethyl)amino)phenylalanine |
| 4-[bis-(2-chloro-ethyl)-amino]-DL-phenylalanine |
| Sarcolysin |
| Mephalan |
| 4-[Bis-(2-chlor-aethyl)-amino]-DL-phenylalanin |
| D-Sarcolysine |
| Sarkolysin |
| p-[trans-4-(1E-Propenyl)cyclohexyl]benzonitrile |
| p-[bis-(2-chloroethyl)-amino]-DL-phenylalanine |
| Medfalan |
| Sarcolysine |
| Merfalan |