N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide
N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide structure
|
Common Name | N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 962-07-2 | Molecular Weight | 253.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide (CAS: 962-07-2), molecular formula C16H15NO2, molecular weight 253.29600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO2 |
|---|---|
| Molecular Weight | 253.29600 |
| Exact Mass | 253.11000 |
| PSA | 46.17000 |
| LogP | 3.27950 |
| InChIKey | VNNCSBAIYQUDDU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CC(=O)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
N-(4-Methylphen... CAS#:962-07-2 |
| Literature: Aznar, Fernando; Valdes, Carlos; Cabal, Maria-Paz Tetrahedron Letters, 2000 , vol. 41, # 30 p. 5683 - 5687 |
|
~%
N-(4-Methylphen... CAS#:962-07-2 |
| Literature: Duguay,G.; Quiniou,H. Bulletin de la Societe Chimique de France, 1972 , p. 637 - 645 Full Text Show Details Andrisano Bollettino Scientifico della Facolta di Chimica Industriale di Bologna, 1950 , vol. 8, p. 4 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-o-Anisyl-3-oxo-3-phenyl-propionamid |
| 3-oxo-3-phenyl-propionic acid o-anisidide |
| benzenepropanamide,n-(2-methoxyphenyl)-|A-oxo |
| N-p-Tolyl-3-oxo-3-phenyl-propionamid |
| 3-Oxo-3-phenyl-propionsaeure-p-toluidid |
| 3-oxo-3-phenyl-propionic acid p-toluidide |
| Benzoylacet-o-anisidide |
| 3-Oxo-3-phenyl-propionsaeure-o-anisidid |
| Benzoylessigsaeure-<4-methyl-anilid> |
| o-ACETANISIDIDE,BENZOYL |
| 92-16-0 |
| N-(p-tolyl)-3-oxo-3-phenylpropanamide |
| 2-Benzoyl-2'-methoxyacetanilide |
| 2-Benzoyl-o-acetanisidid |
| Benzoylessigsaeure-p-toluidid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: Polar surface area (PSA) of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is 46.17000. |
| Q: What is the molecular weight of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: Molecular weight of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is 253.29600. |
| Q: What is the English name of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: The English name of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide. |
| Q: What is the LogP of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: LogP of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is 3.27950. |
| Q: What is the molecular formula of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: Molecular formula of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is C16H15NO2. |
| Q: What is the CAS number of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: CAS number of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is 962-07-2. |
| Q: What is the InChIKey of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: InChIKey of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is VNNCSBAIYQUDDU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide? |
| A: SMILES notation of N-(4-Methylphenyl)-3-oxo-3-phenylpropanamide is Cc1ccc(NC(=O)CC(=O)c2ccccc2)cc1. |
| Q: What is the Chinese name of 962-07-2? |
| A: Chinese name of 962-07-2 is 962-07-2. |