N-[tert-butyl(dimethyl)silyl]-1-phenylmethanamine structure
|
Common Name | N-[tert-butyl(dimethyl)silyl]-1-phenylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 96201-10-4 | Molecular Weight | 221.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[tert-butyl(dimethyl)silyl]-1-phenylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H23NSi |
|---|---|
| Molecular Weight | 221.41400 |
| Exact Mass | 221.16000 |
| PSA | 12.03000 |
| LogP | 4.17230 |
| InChIKey | PCVGNYJCORRBMN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)NCc1ccccc1 |
|
~99%
N-[tert-butyl(d... CAS#:96201-10-4 |
| Literature: Yamamoto, Keiji; Takemae, Makoto Bulletin of the Chemical Society of Japan, 1989 , vol. 62, # 6 p. 2111 - 2113 |
|
~10%
N-[tert-butyl(d... CAS#:96201-10-4 |
| Literature: Aizpurua, Jesus M.; Palomo, Claudio Tetrahedron Letters, 1985 , vol. 26, # 4 p. 475 - 476 |
| benzyl(tert-butyldimethylsilyl)amine |
| N-(t-butyldimethylsilyl)benzylamine |
| Silanamine,1-(1,1-dimethylethyl)-1,1-dimethyl-N-(phenylmethyl) |