Ciglitazone, (R)
Modify Date: 2026-06-26 12:30:21
Ciglitazone, (R) structure
|
Common Name | Ciglitazone, (R) | ||
|---|---|---|---|---|
| CAS Number | 96207-25-9 | Molecular Weight | 333.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ciglitazone, (R) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H23NO3S |
|---|---|
| Molecular Weight | 333.4 |
| InChIKey | YZFWTZACSRHJQD-OAHLLOKOSA-N |
| SMILES | CC1(CCCCC1)COC2=CC=C(C=C2)C[C@@H]3C(=O)NC(=O)S3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 19, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ciglitazone, (R)? |
| A: The English name of Ciglitazone, (R) is Ciglitazone, (R). |
| Q: What is the InChIKey of Ciglitazone, (R)? |
| A: InChIKey of Ciglitazone, (R) is YZFWTZACSRHJQD-OAHLLOKOSA-N. |
| Q: What is the molecular weight of Ciglitazone, (R)? |
| A: Molecular weight of Ciglitazone, (R) is 333.4. |
| Q: What is the molecular formula of Ciglitazone, (R)? |
| A: Molecular formula of Ciglitazone, (R) is C18H23NO3S. |
| Q: What is the SMILES notation of Ciglitazone, (R)? |
| A: SMILES notation of Ciglitazone, (R) is CC1(CCCCC1)COC2=CC=C(C=C2)C[C@@H]3C(=O)NC(=O)S3. |
| Q: What is the CAS number of Ciglitazone, (R)? |
| A: CAS number of Ciglitazone, (R) is 96207-25-9. |
| Q: What is the Chinese name of 96207-25-9? |
| A: Chinese name of 96207-25-9 is 96207-25-9. |