sultropen structure
|
Common Name | sultropen | ||
|---|---|---|---|---|
| CAS Number | 963-22-4 | Molecular Weight | 302.30400 | |
| Density | 1.368g/cm3 | Boiling Point | 487ºC at 760mmHg | |
| Molecular Formula | C11H14N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.3ºC | |
| Name | sultropen |
|---|---|
| Synonym | More Synonyms |
| Density | 1.368g/cm3 |
|---|---|
| Boiling Point | 487ºC at 760mmHg |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.30400 |
| Flash Point | 248.3ºC |
| Exact Mass | 302.05700 |
| PSA | 134.16000 |
| LogP | 4.59410 |
| Index of Refraction | 1.553 |
| InChIKey | PTWBGBDKDZWGCL-UHFFFAOYSA-N |
| SMILES | CCCCCS(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2.4-Dinitro-1-pentylsulfon-benzol |
| 2,4-dinitro-1-pentylsulfonylbenzene |
| (2,4-dinitro-phenyl)-pentyl sulfone |
| Sultropen [ISO] |
| Benzene,2,4-dinitro-1-(pentylsulfonyl) |
| 2,4-dinitro-1-(pentylsulfonyl)benzene |
| 2,4-dinitro-1-(pentane-1-sulfonyl)benzene |
| UNII-4U3T32MV2I |
| (2,4-Dinitro-phenyl)-pentyl-sulfon |
| Sultropen |
| 2,4-dinitrophenyl pentyl sulfone |