Dehydro Felodipine structure
|
Common Name | Dehydro Felodipine | ||
|---|---|---|---|---|
| CAS Number | 96382-71-7 | Molecular Weight | 382.23800 | |
| Density | 1.288g/cm3 | Boiling Point | 444.8ºC at 760mmHg | |
| Molecular Formula | C18H17Cl2NO4 | Melting Point | 70-73ºC | |
| MSDS | N/A | Flash Point | 222.8ºC | |
| Name | 3-O-ethyl 5-O-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 444.8ºC at 760mmHg |
| Melting Point | 70-73ºC |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.23800 |
| Flash Point | 222.8ºC |
| Exact Mass | 381.05300 |
| PSA | 65.49000 |
| LogP | 4.63550 |
| Index of Refraction | 1.564 |
| InChIKey | REQRUBNOOIAHMG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)nc(C)c(C(=O)OC)c1-c1cccc(Cl)c1Cl |
| Storage condition | -20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| HS Code | 2933399090 |
|
~%
Dehydro Felodipine CAS#:96382-71-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 6 p. 1838 - 1844 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Felodipine M (dehydro) |
| 4-(2,3-Dichlorophenyl)-2,6-dimethyl-3,5-pyridinedicarboxylic Acid Ethyl Methyl Ester |
| H 152/37 |
| 4-(2,3-Dichlorophenyl)-2,6-dimethyl pyridine-3,5dicarboxylic acid 3-ethyl ester 5-methyl ester |
| Dehydrofelodipine |
| Dehydro Felodipine |
| Felodipine Impurity 1 |