2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate
Modify Date: 2026-09-20 20:25:37
2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate structure
|
Common Name | 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate | ||
|---|---|---|---|---|
| CAS Number | 96383-54-9 | Molecular Weight | 300.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7Cl5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7Cl5O2 |
|---|---|
| Molecular Weight | 300.4 |
| InChIKey | NWBRBUSHZULGRU-UHFFFAOYSA-N |
| SMILES | C=C(Cl)C(=O)OCC(Cl)CC(Cl)(Cl)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate? |
| A: Molecular weight of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate is 300.4. |
| Q: What is the SMILES notation of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate? |
| A: SMILES notation of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate is C=C(Cl)C(=O)OCC(Cl)CC(Cl)(Cl)Cl. |
| Q: What is the molecular formula of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate? |
| A: Molecular formula of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate is C7H7Cl5O2. |
| Q: What is the InChIKey of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate? |
| A: InChIKey of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate is NWBRBUSHZULGRU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 96383-54-9? |
| A: Chinese name of 96383-54-9 is 96383-54-9. |
| Q: What is the CAS number of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate? |
| A: CAS number of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate is 96383-54-9. |
| Q: What is the English name of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate? |
| A: The English name of 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate is 2,4,4,4-Tetrachlorobutyl 2-chloro-2-propenoate. |