4-Benzyl-2H-1,2,4-benzothiadiazin-3(4H)-on-1,1-dioxide structure
|
Common Name | 4-Benzyl-2H-1,2,4-benzothiadiazin-3(4H)-on-1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 964-08-9 | Molecular Weight | 288.32200 | |
| Density | 1.408g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-benzyl-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.408g/cm3 |
|---|---|
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.32200 |
| Exact Mass | 288.05700 |
| PSA | 74.86000 |
| LogP | 3.57970 |
| Index of Refraction | 1.655 |
| InChIKey | AXSIIVGAOIWSJU-UHFFFAOYSA-N |
| SMILES | O=C1NS(=O)(=O)c2ccccc2N1Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
4-Benzyl-2H-1,2... CAS#:964-08-9 |
| Literature: Magnien,E. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 821 - 823 |
|
~%
4-Benzyl-2H-1,2... CAS#:964-08-9 |
| Literature: Schlaepfer-Daehler, Marlise; Heimgartner, Heinz Helvetica Chimica Acta, 1993 , vol. 76, # 6 p. 2398 - 2406 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Benzyl-2H-1,2,4-benzothiadiazin-3(4H)-on-1,1 |
| 4-benzyl-1,1-dioxo-1 |
| 4-Benzyl-3,4-dihydro-2H-1,2,4-benzothiadiazin-3-on-1,1-dioxid |
| 4-Benzyl-3-oxo-3,4-dihydro-1,2,4-benzothiadiazin-1,1-dioxid |
| 4-Benzyl-2H-1,2,4-benzothiadiazin-3(4H)-on-1,1-dioxide |