1,3-dimethyl-7-phenylpteridine-2,4-dione
1,3-dimethyl-7-phenylpteridine-2,4-dione structure
|
Common Name | 1,3-dimethyl-7-phenylpteridine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 964-45-4 | Molecular Weight | 268.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,3-Dimethyl-7-phenylpteridine-2,4-dione (CAS number: 964-45-4, molecular formula: C14H12N4O2, molecular weight: 268.27), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dimethyl-7-phenylpteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12N4O2 |
|---|---|
| Molecular Weight | 268.27100 |
| Exact Mass | 268.09600 |
| PSA | 69.78000 |
| LogP | 0.69420 |
| InChIKey | CGMXSXCINFWYPM-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2ncc(-c3ccccc3)nc2n(C)c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
1,3-dimethyl-7-... CAS#:964-45-4 |
| Literature: Singh; Geetanjali Russian Journal of Organic Chemistry, 2006 , vol. 42, # 1 p. 136 - 138 |
|
~%
1,3-dimethyl-7-... CAS#:964-45-4 |
| Literature: Dick et al. Journal of the Chemical Society, 1956 , p. 2131,2135 |
|
~%
1,3-dimethyl-7-... CAS#:964-45-4 |
| Literature: Dick et al. Journal of the Chemical Society, 1956 , p. 2131,2135 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-dimethyl-7-phenyllumazine |
| 1,3-dimethyl-7-phenyl-2,4(1H,3H)-pteridinedione |
| 1,3-Dimethyl-2,4-dioxo-7-phenyl(1H,3H)pteridin |
| 1,3-Dimethyl-7-phenyllumazin |
| 1,3-dimethyl-7-phenyl-1H-pteridine-2,4-dione |
| 1,3-Dimethyl-7-phenyl-2,4(1H,3H)-pteridindion |
| 1,3-Dimethyl-7-phenyl-1H-pteridin-2,4-dion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: Molecular weight of 1,3-dimethyl-7-phenylpteridine-2,4-dione is 268.27100. |
| Q: What is the polar surface area (PSA) of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: Polar surface area (PSA) of 1,3-dimethyl-7-phenylpteridine-2,4-dione is 69.78000. |
| Q: What is the CAS number of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: CAS number of 1,3-dimethyl-7-phenylpteridine-2,4-dione is 964-45-4. |
| Q: What is the Chinese name of 964-45-4? |
| A: Chinese name of 964-45-4 is 964-45-4. |
| Q: What is the LogP of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: LogP of 1,3-dimethyl-7-phenylpteridine-2,4-dione is 0.69420. |
| Q: What is the molecular formula of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: Molecular formula of 1,3-dimethyl-7-phenylpteridine-2,4-dione is C14H12N4O2. |
| Q: What is the English name of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: The English name of 1,3-dimethyl-7-phenylpteridine-2,4-dione is 1,3-dimethyl-7-phenylpteridine-2,4-dione. |
| Q: What is the SMILES notation of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: SMILES notation of 1,3-dimethyl-7-phenylpteridine-2,4-dione is Cn1c(=O)c2ncc(-c3ccccc3)nc2n(C)c1=O. |
| Q: What English synonyms does 1,3-dimethyl-7-phenylpteridine-2,4-dione have? |
| A: English synonyms of 1,3-dimethyl-7-phenylpteridine-2,4-dione: 1,3-dimethyl-7-phenyllumazine, 1,3-dimethyl-7-phenyl-2,4(1H,3H)-pteridinedione, 1,3-Dimethyl-2,4-dioxo-7-phenyl(1H,3H)pteridin, 1,3-Dimethyl-7-phenyllumazin, 1,3-dimethyl-7-phenyl-1H-pteridine-2,4-dione, 1,3-Dimethyl-7-phenyl-2,4(1H,3H)-pteridindion, 1,3-Dimethyl-7-phenyl-1H-pteridin-2,4-dion. |
| Q: What is the InChIKey of 1,3-dimethyl-7-phenylpteridine-2,4-dione? |
| A: InChIKey of 1,3-dimethyl-7-phenylpteridine-2,4-dione is CGMXSXCINFWYPM-UHFFFAOYSA-N. |