1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one
Modify Date: 2026-07-10 18:18:05
![1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one Structure](https://www.chemsrc.com/extcaspic/161/96474-05-4.png)
1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one structure
|
Common Name | 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 96474-05-4 | Molecular Weight | 206.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N4O2 |
|---|---|
| Molecular Weight | 206.20 |
| InChIKey | ABLLZVRKYUXMHV-UHFFFAOYSA-N |
| SMILES | CCCC(=O)n1ncc2c(=O)[nH]cnc21 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 19, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 96474-05-4? |
| A: Chinese name of 96474-05-4 is 96474-05-4. |
| Q: What is the CAS number of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one? |
| A: CAS number of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is 96474-05-4. |
| Q: What is the SMILES notation of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one? |
| A: SMILES notation of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is CCCC(=O)n1ncc2c(=O)[nH]cnc21. |
| Q: What is the molecular weight of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one? |
| A: Molecular weight of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is 206.20. |
| Q: What is the InChIKey of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one? |
| A: InChIKey of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is ABLLZVRKYUXMHV-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one? |
| A: The English name of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one. |
| Q: What is the molecular formula of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one? |
| A: Molecular formula of 1-Butyryl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one is C9H10N4O2. |