Palonidipine structure
|
Common Name | Palonidipine | ||
|---|---|---|---|---|
| CAS Number | 96515-73-0 | Molecular Weight | 539.60 | |
| Density | 1.216g/cm3 | Boiling Point | 619.1ºC at 760 mmHg | |
| Molecular Formula | C29H34FN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.2ºC | |
Use of PalonidipinePalonidipine is a calcium antagonist which is potential for the therapy of angina-pectoris and hypertension[1][2][3]. |
| Name | Palonidipine |
|---|
| Description | Palonidipine is a calcium antagonist which is potential for the therapy of angina-pectoris and hypertension[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
Calcium[1] |
| References |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 619.1ºC at 760 mmHg |
| Molecular Formula | C29H34FN3O6 |
| Molecular Weight | 539.60 |
| Flash Point | 328.2ºC |
| Exact Mass | 539.24300 |
| PSA | 113.69000 |
| LogP | 5.69510 |
| Index of Refraction | 1.562 |
| InChIKey | MUNSLZPCNUVWCH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC(C)(C)CN(C)Cc2ccccc2)C1c1cc([N+](=O)[O-])ccc1F |