5,7-Dihydroxy-2-isopropyl-4H-chromen-4-one structure
|
Common Name | 5,7-Dihydroxy-2-isopropyl-4H-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 96552-59-9 | Molecular Weight | 220.221 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 398.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.3±21.4 °C | |
| Name | 5,7-Dihydroxy-2-isopropyl-4H-chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.7±42.0 °C at 760 mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.221 |
| Flash Point | 157.3±21.4 °C |
| Exact Mass | 220.073563 |
| PSA | 70.67000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | VGFBRVLVWZEEIJ-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(=O)c2c(O)cc(O)cc2o1 |
| HS Code | 2932999099 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Transrepression of GAL4-fused RXRalpha LBD (unknown origin) expressed in 293T cells a...
Source: ChEMBL
Target: Retinoic acid receptor RXR-alpha
External Id: CHEMBL4321687
|
| 5,7-dihydroxy-2-isopropylchromone |
| 5,7-Dihydroxy-2-isopropyl-4H-chromen-4-one |