2-methyl-6-nitro-3-phenylquinazolin-4-one structure
|
Common Name | 2-methyl-6-nitro-3-phenylquinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 966-91-6 | Molecular Weight | 281.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-6-nitro-3-phenylquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H11N3O3 |
|---|---|
| Molecular Weight | 281.26600 |
| Exact Mass | 281.08000 |
| PSA | 80.71000 |
| LogP | 3.12550 |
| InChIKey | YDXJOYOUVJVSFG-UHFFFAOYSA-N |
| SMILES | Cc1nc2ccc([N+](=O)[O-])cc2c(=O)n1-c1ccccc1 |
|
~%
2-methyl-6-nitr... CAS#:966-91-6 |
| Literature: Bogert; Cook Journal of the American Chemical Society, 1906 , vol. 28, p. 1451 |
| 4(3H)-Quinazolinone,2-methyl-6-nitro-3-phenyl |
| F1967-0943 |
| 2-methyl-6-nitro-3-phenylquinazolin-4(3H)-one |
| 2-Methyl-6-nitro-3-phenyl-3H-chinazolin-4-on |
| 2-Methyl-3-phenyl-6-nitro-chinazolon |
| 2-Methyl-3-phenyl-6-nitro-4(3H)-chinazolon |
| 2-Methyl-3-phenyl-6-nitrochinazolinon-4 |
| 2-methyl-6-nitro-3-phenyl-3H-quinazolin-4-one |