chloro-isothiocyanato-diphenylstannane structure
|
Common Name | chloro-isothiocyanato-diphenylstannane | ||
|---|---|---|---|---|
| CAS Number | 96627-73-5 | Molecular Weight | 366.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNSSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloro-isothiocyanato-diphenylstannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10ClNSSn |
|---|---|
| Molecular Weight | 366.44400 |
| Exact Mass | 366.92400 |
| PSA | 32.09000 |
| LogP | 0.25540 |
| InChIKey | GTCYSDFOSBPVFB-UHFFFAOYSA-M |
| SMILES | S=C=N[Sn](Cl)(c1ccccc1)c1ccccc1 |
|
~14%
Detail
|
| Literature: Srivastava; Tangri Journal of the Indian Chemical Society, 1991 , vol. 68, # 10 p. 560 - 562 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Stannane,chloroisothiocyanatodiphenyl |