Riboflavin 5'-(trihydrogen diphosphate), 1,5-dihydro-, P'-5'-ester with adenosine, ion(1-) structure
|
Common Name | Riboflavin 5'-(trihydrogen diphosphate), 1,5-dihydro-, P'-5'-ester with adenosine, ion(1-) | ||
|---|---|---|---|---|
| CAS Number | 96647-72-2 | Molecular Weight | 786.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H34N9O15P2- | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Riboflavin 5'-(trihydrogen diphosphate), 1,5-dihydro-, P'-5'-ester with adenosine, ion(1-) |
|---|
| Molecular Formula | C27H34N9O15P2- |
|---|---|
| Molecular Weight | 786.6 |
| InChIKey | YPZRHBJKEMOYQH-UYBVJOGSSA-M |
| SMILES | Cc1cc2c(cc1C)N(CC(O)C(O)C(O)COP(=O)(O)OP(=O)(O)OCC1OC(n3cnc4c(N)ncnc43)C(O)C1O)c1nc([O-])[nH]c(=O)c1N2 |