2-[5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethanol structure
|
Common Name | 2-[5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethanol | ||
|---|---|---|---|---|
| CAS Number | 96685-53-9 | Molecular Weight | 268.46700 | |
| Density | 0.939g/cm3 | Boiling Point | 323.116ºC at 760 mmHg | |
| Molecular Formula | C15H28O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.215ºC | |
| Name | 2-[5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 323.116ºC at 760 mmHg |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.46700 |
| Flash Point | 149.215ºC |
| Exact Mass | 268.18600 |
| PSA | 29.46000 |
| LogP | 4.03560 |
| Index of Refraction | 1.476 |
| InChIKey | ACGPHRQKCDCZAG-XXYUJHKVSA-N |
| SMILES | C=C1CCC(O[Si](C)(C)C(C)(C)C)CC1=CCO |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-[5-(tert-butyl-dimethyl-silyloxy)-2-methylene-cyclohexylidene]-ethanol |