2-chloro-n-(2,6-dibromo-4-methylphenyl)acetamide
Modify Date: 2025-09-27 14:54:53
2-chloro-n-(2,6-dibromo-4-methylphenyl)acetamide structure
|
Common Name | 2-chloro-n-(2,6-dibromo-4-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 96686-53-2 | Molecular Weight | 341.42700 | |
| Density | 1.87g/cm3 | Boiling Point | 415ºC at 760mmHg | |
| Molecular Formula | C9H8Br2ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | 2-chloro-n-(2,6-dibromo-4-methylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.87g/cm3 |
|---|---|
| Boiling Point | 415ºC at 760mmHg |
| Molecular Formula | C9H8Br2ClNO |
| Molecular Weight | 341.42700 |
| Flash Point | 204.8ºC |
| Exact Mass | 338.86600 |
| PSA | 29.10000 |
| LogP | 3.77030 |
| Index of Refraction | 1.637 |
| InChIKey | MVANPTOKDQBBEW-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(NC(=O)CCl)c(Br)c1 |
| HS Code | 2924299090 |
|---|
|
~%
2-chloro-n-(2,6... CAS#:96686-53-2 |
| Literature: Loefgren; Lundquist Svensk Kemisk Tidskrift, 1946 , vol. 58, p. 206,211 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| chloro-acetic acid-(2,6-dibromo-4-methyl-anilide) |
| Chlor-essigsaeure-(2,6-dibrom-4-methyl-anilid) |
| N-(2,6-dibromo-4-methylphenyl)-2-chloroacetamide |