(+)-Mollisacacidin structure
|
Common Name | (+)-Mollisacacidin | ||
|---|---|---|---|---|
| CAS Number | 967-27-1 | Molecular Weight | 290.26800 | |
| Density | 1.605g/cm3 | Boiling Point | 583.1ºC at 760mmHg | |
| Molecular Formula | C15H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.5ºC | |
| Name | (+)-mollisacacidin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 583.1ºC at 760mmHg |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.26800 |
| Flash Point | 306.5ºC |
| Exact Mass | 290.07900 |
| PSA | 110.38000 |
| LogP | 1.33140 |
| Index of Refraction | 1.745 |
| InChIKey | OFZBQQUVMQGHDJ-QLFBSQMISA-N |
| SMILES | Oc1ccc2c(c1)OC(c1ccc(O)c(O)c1)C(O)C2O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2R,3S,4R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7-triol |
| (+-)-2r-(3,4-Dihydroxy-phenyl)-chroman-3t,4c,7-triol |
| (2rH)-Flavan-3c,4t,7,3',4'-pentaol,(+-)-Mollisacacidin |
| (2R,3S,4R)-2-(3,4-dihydroxyphenyl)chromane-3,4,7-triol |