[2,2':6',2''-Terpyridine]-4,4',4''-triol
Modify Date: 2026-08-03 15:06:13
![[2,2':6',2''-Terpyridine]-4,4',4''-triol Structure](https://www.chemsrc.com/extcaspic/389/96716-27-7.png)
[2,2':6',2''-Terpyridine]-4,4',4''-triol structure
|
Common Name | [2,2':6',2''-Terpyridine]-4,4',4''-triol | ||
|---|---|---|---|---|
| CAS Number | 96716-27-7 | Molecular Weight | 281.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [2,2':6',2''-Terpyridine]-4,4',4''-triol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11N3O3 |
|---|---|
| Molecular Weight | 281.27 |
| InChIKey | HJCNLAOQZIBROW-UHFFFAOYSA-N |
| SMILES | O=c1cc[nH]c(-c2cc(=O)cc(-c3cc(=O)cc[nH]3)[nH]2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of [2,2':6',2''-Terpyridine]-4,4',4''-triol? |
| A: The English name of [2,2':6',2''-Terpyridine]-4,4',4''-triol is [2,2':6',2''-Terpyridine]-4,4',4''-triol. |
| Q: What is the Chinese name of 96716-27-7? |
| A: Chinese name of 96716-27-7 is 96716-27-7. |
| Q: What is the SMILES notation of [2,2':6',2''-Terpyridine]-4,4',4''-triol? |
| A: SMILES notation of [2,2':6',2''-Terpyridine]-4,4',4''-triol is O=c1cc[nH]c(-c2cc(=O)cc(-c3cc(=O)cc[nH]3)[nH]2)c1. |
| Q: What is the InChIKey of [2,2':6',2''-Terpyridine]-4,4',4''-triol? |
| A: InChIKey of [2,2':6',2''-Terpyridine]-4,4',4''-triol is HJCNLAOQZIBROW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of [2,2':6',2''-Terpyridine]-4,4',4''-triol? |
| A: Molecular formula of [2,2':6',2''-Terpyridine]-4,4',4''-triol is C15H11N3O3. |
| Q: What is the molecular weight of [2,2':6',2''-Terpyridine]-4,4',4''-triol? |
| A: Molecular weight of [2,2':6',2''-Terpyridine]-4,4',4''-triol is 281.27. |
| Q: What is the CAS number of [2,2':6',2''-Terpyridine]-4,4',4''-triol? |
| A: CAS number of [2,2':6',2''-Terpyridine]-4,4',4''-triol is 96716-27-7. |