methyl chloro[(3-methoxylphenyl)hydrazono]acetate structure
|
Common Name | methyl chloro[(3-methoxylphenyl)hydrazono]acetate | ||
|---|---|---|---|---|
| CAS Number | 96722-47-3 | Molecular Weight | 242.65900 | |
| Density | 1.26 g/cm3 | Boiling Point | 330.9ºC at 760 mmHg | |
| Molecular Formula | C10H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.9ºC | |
| Name | methyl chloro[(3-methoxylphenyl)hydrazono]acetate |
|---|
| Density | 1.26 g/cm3 |
|---|---|
| Boiling Point | 330.9ºC at 760 mmHg |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.65900 |
| Flash Point | 153.9ºC |
| Exact Mass | 242.04600 |
| PSA | 59.92000 |
| LogP | 1.90540 |
| Index of Refraction | 1.537 |
| InChIKey | ZLHIFGKYLOUABG-LCYFTJDESA-N |
| SMILES | COC(=O)C(Cl)=NNc1cccc(OC)c1 |
| HS Code | 2928000090 |
|---|
|
~%
methyl chloro[(... CAS#:96722-47-3 |
| Literature: Cocco; Maccioni; Plumitallo Farmaco, Edizione Scientifica, 1985 , vol. 40, # 4 p. 272 - 284 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |